C20H23F3N2O2 — CID 146645442
3-(2,2-dimethyl-1,3-dihydroinden-1-yl)propyl 1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 146645442) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,3-dihydroinden-1-yl)propyl 1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | 3-(2,2-dimethyl-1,3-dihydroinden-1-yl)propyl 1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 146645442 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-(2,2-dimethyl-1,3-dihydroinden-1-yl)propyl 1-methyl-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | Cn1ncc(C(=O)OCCCC2c3ccccc3CC2(C)C)c1C(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O2/c1-19(2)11-13-7-4-5-8-14(13)16(19)9-6-10-27-18(26)15-12-24-25(3)17(15)20(21,22)23/h4-5,7-8,12,16H,6,9-11H2,1-3H3 |
| InChIKey | YTFAWMGUDZCAMZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|