C10H13BrF3N3O2S — CID 146645523
5-bromo-N-(2,2-dimethoxyethyl)-2-methylsulfanyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 146645523) has the molecular formula C10H13BrF3N3O2S and a molecular weight of 376.20 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethoxyethyl)-2-methylsulfanyl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-N-(2,2-dimethoxyethyl)-2-methylsulfanyl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 146645523 |
| Molecular Formula | C10H13BrF3N3O2S |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 5-bromo-N-(2,2-dimethoxyethyl)-2-methylsulfanyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | COC(CNc1nc(SC)nc(C(F)(F)F)c1Br)OC |
| InChI | InChI=1S/C10H13BrF3N3O2S/c1-18-5(19-2)4-15-8-6(11)7(10(12,13)14)16-9(17-8)20-3/h5H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | XVYJDYKGAAPCRU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|