C18H28N4O2S2 — CID 146646174
(3-aminocyclohexyl)-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]methanol (PubChem CID 146646174) has the molecular formula C18H28N4O2S2 and a molecular weight of 396.58 g/mol. Its IUPAC name is (3-aminocyclohexyl)-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]methanol.
| Compound Name | (3-aminocyclohexyl)-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]methanol |
|---|---|
| PubChem CID | 146646174 |
| Molecular Formula | C18H28N4O2S2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (3-aminocyclohexyl)-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]methanol |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(NC(O)C3CCCC(N)C3)s2)o1 |
| InChI | InChI=1S/C18H28N4O2S2/c1-18(2,3)13-8-20-14(24-13)10-25-15-9-21-17(26-15)22-16(23)11-5-4-6-12(19)7-11/h8-9,11-12,16,23H,4-7,10,19H2,1-3H3,(H,21,22) |
| InChIKey | OHMMNQQGHONNBQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|