About N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine
N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine (PubChem CID 146646361) has the molecular formula C9H19FN2
and a molecular weight of 174.26 g/mol. Its IUPAC name is N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine |
| PubChem CID | 146646361 |
| Molecular Formula | C9H19FN2 |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine |
| SMILES | CCCC1(N(F)CCNC)CC1 |
| InChI | InChI=1S/C9H19FN2/c1-3-4-9(5-6-9)12(10)8-7-11-2/h11H,3-8H2,1-2H3 |
| InChIKey | OFBIACYGZVCADP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine?
The IUPAC name of N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine (CID 146646361) is N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine.
What is the SMILES notation for N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine?
The canonical SMILES for N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine is CCCC1(N(F)CCNC)CC1.
What is the InChIKey of N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine?
The InChIKey is OFBIACYGZVCADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19FN2/c1-3-4-9(5-6-9)12(10)8-7-11-2/h11H,3-8H2,1-2H3.
What are the key properties of N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine?
N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine has a molecular weight of 174.26 g/mol, XLogP of 1.73, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-fluoro-N-methyl-N'-(1-propylcyclopropyl)ethane-1,2-diamine is sourced from PubChem (CID 146646361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).