C18H25F3N2 — CID 146646548
(Z)-N-[(E)-but-1-enyl]-N'-[(2E,3Z)-2-ethylidene-5-(trifluoromethyl)hepta-3,5-dienyl]but-2-enimidamide (PubChem CID 146646548) has the molecular formula C18H25F3N2 and a molecular weight of 326.41 g/mol. Its IUPAC name is (Z)-N-[(E)-but-1-enyl]-N'-[(2E,3Z)-2-ethylidene-5-(trifluoromethyl)hepta-3,5-dienyl]but-2-enimidamide.
| Compound Name | (Z)-N-[(E)-but-1-enyl]-N'-[(2E,3Z)-2-ethylidene-5-(trifluoromethyl)hepta-3,5-dienyl]but-2-enimidamide |
|---|---|
| PubChem CID | 146646548 |
| Molecular Formula | C18H25F3N2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (Z)-N-[(E)-but-1-enyl]-N'-[(2E,3Z)-2-ethylidene-5-(trifluoromethyl)hepta-3,5-dienyl]but-2-enimidamide |
| SMILES | CC=C(/C=C\C(=C/C)C/N=C(\C=C/C)N/C=C/CC)C(F)(F)F |
| InChI | InChI=1S/C18H25F3N2/c1-5-9-13-22-17(10-6-2)23-14-15(7-3)11-12-16(8-4)18(19,20)21/h6-13H,5,14H2,1-4H3,(H,22,23)/b10-6-,12-11-,13-9+,15-7+,16-8? |
| InChIKey | LMIYLUSPIOLLHL-HYLAPEJZSA-N |
| XLogP | 5.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|