C38H42N4 — CID 146646715
4-[5-(1,2,4a,7,8,8a,9,9a,10,10a-decahydroanthracen-9-yl)-4-(azet-2-yl)cyclohexa-1,3-dien-1-yl]-2-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,4-dihydro-1,3,5-triazine (PubChem CID 146646715) has the molecular formula C38H42N4 and a molecular weight of 554.78 g/mol. Its IUPAC name is 4-[5-(1,2,4a,7,8,8a,9,9a,10,10a-decahydroanthracen-9-yl)-4-(azet-2-yl)cyclohexa-1,3-dien-1-yl]-2-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 4-[5-(1,2,4a,7,8,8a,9,9a,10,10a-decahydroanthracen-9-yl)-4-(azet-2-yl)cyclohexa-1,3-dien-1-yl]-2-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 146646715 |
| Molecular Formula | C38H42N4 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | 4-[5-(1,2,4a,7,8,8a,9,9a,10,10a-decahydroanthracen-9-yl)-4-(azet-2-yl)cyclohexa-1,3-dien-1-yl]-2-cyclohexa-1,3-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=CCCC(C2=NC(C3=CC=C(C4=CC=N4)C(C4C5CCC=CC5CC5C=CCCC54)C3)N=C(C3C=CC=CC3)N2)=C1 |
| InChI | InChI=1S/C38H42N4/c1-3-11-25(12-4-1)36-40-37(26-13-5-2-6-14-26)42-38(41-36)29-19-20-32(34-21-22-39-34)33(24-29)35-30-17-9-7-15-27(30)23-28-16-8-10-18-31(28)35/h1-5,7-8,11,13,15-16,19-22,25,27-28,30-31,33,35,38H,6,9-10,12,14,17-18,23-24H2,(H,40,41,42) |
| InChIKey | XFUWWEUHWPEZSE-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|