C45H54N4 — CID 146646720
2-[6-(4a-methyl-9,9a-dihydro-8aH-anthracen-9-yl)-4-(4-cyclohexa-1,5-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-5-methyl-1,3,5-triazinan-2-yl)cyclohex-3-en-1-yl]-3a,4,5,7a-tetrahydro-1H-indole (PubChem CID 146646720) has the molecular formula C45H54N4 and a molecular weight of 650.95 g/mol. Its IUPAC name is 2-[6-(4a-methyl-9,9a-dihydro-8aH-anthracen-9-yl)-4-(4-cyclohexa-1,5-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-5-methyl-1,3,5-triazinan-2-yl)cyclohex-3-en-1-yl]-3a,4,5,7a-tetrahydro-1H-indole.
| Compound Name | 2-[6-(4a-methyl-9,9a-dihydro-8aH-anthracen-9-yl)-4-(4-cyclohexa-1,5-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-5-methyl-1,3,5-triazinan-2-yl)cyclohex-3-en-1-yl]-3a,4,5,7a-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 146646720 |
| Molecular Formula | C45H54N4 |
| Molecular Weight | 650.95 g/mol |
| Exact Mass | 650.43 |
| IUPAC Name | 2-[6-(4a-methyl-9,9a-dihydro-8aH-anthracen-9-yl)-4-(4-cyclohexa-1,5-dien-1-yl-6-cyclohexa-2,4-dien-1-yl-5-methyl-1,3,5-triazinan-2-yl)cyclohex-3-en-1-yl]-3a,4,5,7a-tetrahydro-1H-indole |
| SMILES | CN1C(C2=CCCC=C2)NC(C2=CCC(C3=CC4CCC=CC4N3)C(C3C4C=CC=CC4=CC4(C)C=CC=CC34)C2)NC1C1C=CC=CC1 |
| InChI | InChI=1S/C45H54N4/c1-45-26-14-13-22-38(45)41(35-21-11-9-20-34(35)29-45)37-27-33(24-25-36(37)40-28-32-19-10-12-23-39(32)46-40)42-47-43(30-15-5-3-6-16-30)49(2)44(48-42)31-17-7-4-8-18-31/h3,5-7,9,11-15,17-18,20-24,26,28-30,32,35-39,41-44,46-48H,4,8,10,16,19,25,27H2,1-2H3 |
| InChIKey | HSAQVVYTZQZJLW-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.95 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|