C36H37N5 — CID 146646733
9-[5-(2-cyclohexa-1,5-dien-1-yl-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-2-(2,3-dihydroazet-2-yl)cyclohex-2-en-1-yl]-9,9a-dihydro-8aH-benzo[f]indole (PubChem CID 146646733) has the molecular formula C36H37N5 and a molecular weight of 539.73 g/mol. Its IUPAC name is 9-[5-(2-cyclohexa-1,5-dien-1-yl-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-2-(2,3-dihydroazet-2-yl)cyclohex-2-en-1-yl]-9,9a-dihydro-8aH-benzo[f]indole.
| Compound Name | 9-[5-(2-cyclohexa-1,5-dien-1-yl-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-2-(2,3-dihydroazet-2-yl)cyclohex-2-en-1-yl]-9,9a-dihydro-8aH-benzo[f]indole |
|---|---|
| PubChem CID | 146646733 |
| Molecular Formula | C36H37N5 |
| Molecular Weight | 539.73 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | 9-[5-(2-cyclohexa-1,5-dien-1-yl-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)-2-(2,3-dihydroazet-2-yl)cyclohex-2-en-1-yl]-9,9a-dihydro-8aH-benzo[f]indole |
| SMILES | C1=CC2=CC3=CC=NC3C(C3CC(C4=NC(c5ccccc5)NC(C5=CCCC=C5)N4)CC=C3C3CC=N3)C2C=C1 |
| InChI | InChI=1S/C36H37N5/c1-3-9-23(10-4-1)34-39-35(24-11-5-2-6-12-24)41-36(40-34)27-15-16-29(31-18-20-37-31)30(22-27)32-28-14-8-7-13-25(28)21-26-17-19-38-33(26)32/h1,3-5,7-14,16-17,19-21,27-28,30-35,39H,2,6,15,18,22H2,(H,40,41) |
| InChIKey | AEHRKLASYGBUNB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 61.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|