About trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium
trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium (PubChem CID 146646954) has the molecular formula C14H24NO+
and a molecular weight of 222.35 g/mol. Its IUPAC name is trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium.
Molecular Properties
| Compound Name | trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium |
| PubChem CID | 146646954 |
| Molecular Formula | C14H24NO+ |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium |
| SMILES | C=C=CCC(C[N+](C)(C)C)OC(=C=C)CC |
| InChI | InChI=1S/C14H24NO/c1-7-10-11-14(12-15(4,5)6)16-13(8-2)9-3/h10,14H,1-2,9,11-12H2,3-6H3/q+1 |
| InChIKey | VNQMQMTWDZDSHU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium?
The IUPAC name of trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium (CID 146646954) is trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium.
What is the SMILES notation for trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium?
The canonical SMILES for trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium is C=C=CCC(C[N+](C)(C)C)OC(=C=C)CC.
What is the InChIKey of trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium?
The InChIKey is VNQMQMTWDZDSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24NO/c1-7-10-11-14(12-15(4,5)6)16-13(8-2)9-3/h10,14H,1-2,9,11-12H2,3-6H3/q+1.
What are the key properties of trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium?
trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium has a molecular weight of 222.35 g/mol, XLogP of 2.89, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(2-penta-1,2-dien-3-yloxyhexa-4,5-dienyl)azanium is sourced from PubChem (CID 146646954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).