About 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine
1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine (PubChem CID 146647488) has the molecular formula C12H23F2N
and a molecular weight of 219.32 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine |
| PubChem CID | 146647488 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC1(C)CC1C(F)(NCCF)C(C)(C)C |
| InChI | InChI=1S/C12H23F2N/c1-10(2,3)12(14,15-7-6-13)9-8-11(9,4)5/h9,15H,6-8H2,1-5H3 |
| InChIKey | PBOJCSGLDRDYPF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine?
The IUPAC name of 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine (CID 146647488) is 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine?
The canonical SMILES for 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine is CC1(C)CC1C(F)(NCCF)C(C)(C)C.
What is the InChIKey of 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine?
The InChIKey is PBOJCSGLDRDYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2N/c1-10(2,3)12(14,15-7-6-13)9-8-11(9,4)5/h9,15H,6-8H2,1-5H3.
What are the key properties of 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine?
1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine has a molecular weight of 219.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylcyclopropyl)-1-fluoro-N-(2-fluoroethyl)-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 146647488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).