About 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid
2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid (PubChem CID 146647536) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid |
| PubChem CID | 146647536 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid |
| SMILES | CSN1CC=C(CC(=O)O)CC1 |
| InChI | InChI=1S/C8H13NO2S/c1-12-9-4-2-7(3-5-9)6-8(10)11/h2H,3-6H2,1H3,(H,10,11) |
| InChIKey | OZMHOUZONMGRHX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid?
The IUPAC name of 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid (CID 146647536) is 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid.
What is the SMILES notation for 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid?
The canonical SMILES for 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid is CSN1CC=C(CC(=O)O)CC1.
What is the InChIKey of 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid?
The InChIKey is OZMHOUZONMGRHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2S/c1-12-9-4-2-7(3-5-9)6-8(10)11/h2H,3-6H2,1H3,(H,10,11).
What are the key properties of 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid?
2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid has a molecular weight of 187.26 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylsulfanyl-3,6-dihydro-2H-pyridin-4-yl)acetic acid is sourced from PubChem (CID 146647536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).