C23H22N8O2 — CID 146647558
1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]ethanone (PubChem CID 146647558) has the molecular formula C23H22N8O2 and a molecular weight of 442.48 g/mol. Its IUPAC name is 1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]ethanone.
| Compound Name | 1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 146647558 |
| Molecular Formula | C23H22N8O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]ethanone |
| SMILES | O=C(Cc1nnc(-c2cnc(NC3Cc4ccccc4C3)nc2)o1)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C23H22N8O2/c32-21(31-8-7-30-6-5-24-19(30)14-31)11-20-28-29-22(33-20)17-12-25-23(26-13-17)27-18-9-15-3-1-2-4-16(15)10-18/h1-6,12-13,18H,7-11,14H2,(H,25,26,27) |
| InChIKey | CGBLPDVUYUECTI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |