About (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide
(3S)-2-(fluoromethyl)-N,3-dimethylpentanamide (PubChem CID 146647990) has the molecular formula C8H16FNO
and a molecular weight of 161.22 g/mol. Its IUPAC name is (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide.
Molecular Properties
| Compound Name | (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide |
| PubChem CID | 146647990 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide |
| SMILES | CC[C@H](C)C(CF)C(=O)NC |
| InChI | InChI=1S/C8H16FNO/c1-4-6(2)7(5-9)8(11)10-3/h6-7H,4-5H2,1-3H3,(H,10,11)/t6-,7?/m0/s1 |
| InChIKey | OMGKDVJDEKGSRZ-PKPIPKONSA-N |
| XLogP | 1.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide?
The IUPAC name of (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide (CID 146647990) is (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide.
What is the SMILES notation for (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide?
The canonical SMILES for (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide is CC[C@H](C)C(CF)C(=O)NC.
What is the InChIKey of (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide?
The InChIKey is OMGKDVJDEKGSRZ-PKPIPKONSA-N. The full InChI is InChI=1S/C8H16FNO/c1-4-6(2)7(5-9)8(11)10-3/h6-7H,4-5H2,1-3H3,(H,10,11)/t6-,7?/m0/s1.
What are the key properties of (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide?
(3S)-2-(fluoromethyl)-N,3-dimethylpentanamide has a molecular weight of 161.22 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2-(fluoromethyl)-N,3-dimethylpentanamide is sourced from PubChem (CID 146647990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).