C60H39N7 — CID 146648753
4-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,9-diphenylcarbazole (PubChem CID 146648753) has the molecular formula C60H39N7 and a molecular weight of 858.02 g/mol. Its IUPAC name is 4-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,9-diphenylcarbazole.
| Compound Name | 4-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,9-diphenylcarbazole |
|---|---|
| PubChem CID | 146648753 |
| Molecular Formula | C60H39N7 |
| Molecular Weight | 858.02 g/mol |
| Exact Mass | 857.33 |
| IUPAC Name | 4-[2,4-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,9-diphenylcarbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc(-c5ccccc5)c5c4c4ccccc4n5-c4ccccc4)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C60H39N7/c1-7-21-40(22-8-1)47-37-38-49(53-50-33-19-20-34-52(50)67(54(47)53)46-31-17-6-18-32-46)48-36-35-45(59-63-55(41-23-9-2-10-24-41)61-56(64-59)42-25-11-3-12-26-42)39-51(48)60-65-57(43-27-13-4-14-28-43)62-58(66-60)44-29-15-5-16-30-44/h1-39H |
| InChIKey | JJHDDJQKDDMAPE-UHFFFAOYSA-N |
| XLogP | 14.49 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.02 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |