C60H39N7S — CID 146648770
4-[4-(4-dibenzothiophen-4-yl-6-phenyl-1,2-dihydro-1,3,5-triazin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole (PubChem CID 146648770) has the molecular formula C60H39N7S and a molecular weight of 890.09 g/mol. Its IUPAC name is 4-[4-(4-dibenzothiophen-4-yl-6-phenyl-1,2-dihydro-1,3,5-triazin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole.
| Compound Name | 4-[4-(4-dibenzothiophen-4-yl-6-phenyl-1,2-dihydro-1,3,5-triazin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 146648770 |
| Molecular Formula | C60H39N7S |
| Molecular Weight | 890.09 g/mol |
| Exact Mass | 889.30 |
| IUPAC Name | 4-[4-(4-dibenzothiophen-4-yl-6-phenyl-1,2-dihydro-1,3,5-triazin-2-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-phenylcarbazole |
| SMILES | c1ccc(C2=NC(c3cccc4c3sc3ccccc34)=NC(c3ccc(-c4cccc5c4c4ccccc4n5-c4ccccc4)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)N2)cc1 |
| InChI | InChI=1S/C60H39N7S/c1-5-19-38(20-6-1)55-61-56(39-21-7-2-8-22-39)65-60(64-55)49-37-41(35-36-43(49)45-29-18-33-51-53(45)47-28-13-15-32-50(47)67(51)42-25-11-4-12-26-42)58-62-57(40-23-9-3-10-24-40)63-59(66-58)48-31-17-30-46-44-27-14-16-34-52(44)68-54(46)48/h1-37,58H,(H,62,63,66) |
| InChIKey | LIUCLVRYRMGFCA-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 80.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.09 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |