C64H41N3 — CID 146648937
2,4-bis(3-phenylphenyl)-6-[3-[3-(9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 146648937) has the molecular formula C64H41N3 and a molecular weight of 852.05 g/mol. Its IUPAC name is 2,4-bis(3-phenylphenyl)-6-[3-[3-(9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(3-phenylphenyl)-6-[3-[3-(9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 146648937 |
| Molecular Formula | C64H41N3 |
| Molecular Weight | 852.05 g/mol |
| Exact Mass | 851.33 |
| IUPAC Name | 2,4-bis(3-phenylphenyl)-6-[3-[3-(9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4cccc(-c5ccccc5)c4)nc(-c4cccc(-c5cccc(-c6ccc7c(c6)C6(c8ccccc8-c8ccccc86)c6ccccc6-7)c5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C64H41N3/c1-3-17-42(18-4-1)44-21-14-26-50(38-44)61-65-62(51-27-15-22-45(39-51)43-19-5-2-6-20-43)67-63(66-61)52-28-16-25-48(40-52)46-23-13-24-47(37-46)49-35-36-56-55-31-9-12-34-59(55)64(60(56)41-49)57-32-10-7-29-53(57)54-30-8-11-33-58(54)64/h1-41H |
| InChIKey | UXISETGWEPPKFC-UHFFFAOYSA-N |
| XLogP | 15.88 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.05 |
| LogP ≤ 5 | 15.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |