About 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol
5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol (PubChem CID 146649199) has the molecular formula C18H36O3
and a molecular weight of 300.48 g/mol. Its IUPAC name is 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol.
Molecular Properties
| Compound Name | 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol |
| PubChem CID | 146649199 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol |
| SMILES | CCOC(CC(C)(C)C1CCCO1)C(CC)C(C)(O)CC |
| InChI | InChI=1S/C18H36O3/c1-7-14(18(6,19)8-2)15(20-9-3)13-17(4,5)16-11-10-12-21-16/h14-16,19H,7-13H2,1-6H3 |
| InChIKey | ISJCAPPISLORCO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol?
The IUPAC name of 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol (CID 146649199) is 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol.
What is the SMILES notation for 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol?
The canonical SMILES for 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol is CCOC(CC(C)(C)C1CCCO1)C(CC)C(C)(O)CC.
What is the InChIKey of 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol?
The InChIKey is ISJCAPPISLORCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3/c1-7-14(18(6,19)8-2)15(20-9-3)13-17(4,5)16-11-10-12-21-16/h14-16,19H,7-13H2,1-6H3.
What are the key properties of 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol?
5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol has a molecular weight of 300.48 g/mol, XLogP of 4.17, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-4-ethyl-3,7-dimethyl-7-(oxolan-2-yl)octan-3-ol is sourced from PubChem (CID 146649199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).