C15H20O2S — CID 14664943
2,2-dimethyl-6-(4-methylphenyl)sulfanyl-5-oxohexanal (PubChem CID 14664943) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4-methylphenyl)sulfanyl-5-oxohexanal.
| Compound Name | 2,2-dimethyl-6-(4-methylphenyl)sulfanyl-5-oxohexanal |
|---|---|
| PubChem CID | 14664943 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2,2-dimethyl-6-(4-methylphenyl)sulfanyl-5-oxohexanal |
| SMILES | Cc1ccc(SCC(=O)CCC(C)(C)C=O)cc1 |
| InChI | InChI=1S/C15H20O2S/c1-12-4-6-14(7-5-12)18-10-13(17)8-9-15(2,3)11-16/h4-7,11H,8-10H2,1-3H3 |
| InChIKey | BWNFYUUJIURDLF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|