About 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine
4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine (PubChem CID 146649554) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine.
Molecular Properties
| Compound Name | 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine |
| PubChem CID | 146649554 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine |
| SMILES | CCC1=CCC(CC/C(C)=N/C)C=C1 |
| InChI | InChI=1S/C13H21N/c1-4-12-7-9-13(10-8-12)6-5-11(2)14-3/h7-9,13H,4-6,10H2,1-3H3/b14-11+ |
| InChIKey | UXCSEYPQKHXCQO-SDNWHVSQSA-N |
| XLogP | 3.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine?
The IUPAC name of 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine (CID 146649554) is 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine.
What is the SMILES notation for 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine?
The canonical SMILES for 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine is CCC1=CCC(CC/C(C)=N/C)C=C1.
What is the InChIKey of 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine?
The InChIKey is UXCSEYPQKHXCQO-SDNWHVSQSA-N. The full InChI is InChI=1S/C13H21N/c1-4-12-7-9-13(10-8-12)6-5-11(2)14-3/h7-9,13H,4-6,10H2,1-3H3/b14-11+.
What are the key properties of 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine?
4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine has a molecular weight of 191.32 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethylcyclohexa-2,4-dien-1-yl)-N-methylbutan-2-imine is sourced from PubChem (CID 146649554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).