About 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide
2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide (PubChem CID 146649773) has the molecular formula C18H18F2N4OS
and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 146649773 |
| Molecular Formula | C18H18F2N4OS |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1sc(N(C#N)c2cc(F)cc(F)c2)nc1C(=O)NC1(C)CCCC1 |
| InChI | InChI=1S/C18H18F2N4OS/c1-11-15(16(25)23-18(2)5-3-4-6-18)22-17(26-11)24(10-21)14-8-12(19)7-13(20)9-14/h7-9H,3-6H2,1-2H3,(H,23,25) |
| InChIKey | CRQDAFJYGKUAHS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide (CID 146649773) is 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide is Cc1sc(N(C#N)c2cc(F)cc(F)c2)nc1C(=O)NC1(C)CCCC1.
What is the InChIKey of 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide?
The InChIKey is CRQDAFJYGKUAHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2N4OS/c1-11-15(16(25)23-18(2)5-3-4-6-18)22-17(26-11)24(10-21)14-8-12(19)7-13(20)9-14/h7-9H,3-6H2,1-2H3,(H,23,25).
What are the key properties of 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide?
2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide has a molecular weight of 376.43 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-cyano-3,5-difluoroanilino)-5-methyl-N-(1-methylcyclopentyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 146649773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).