About N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide
N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide (PubChem CID 146650292) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide.
Molecular Properties
| Compound Name | N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide |
| PubChem CID | 146650292 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide |
| SMILES | O=S(=O)(NO)c1cc2c(o1)=CCCC=2 |
| InChI | InChI=1S/C8H9NO4S/c10-9-14(11,12)8-5-6-3-1-2-4-7(6)13-8/h3-5,9-10H,1-2H2 |
| InChIKey | UHYTWTOQMYEJRR-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide?
The IUPAC name of N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide (CID 146650292) is N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide.
What is the SMILES notation for N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide?
The canonical SMILES for N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide is O=S(=O)(NO)c1cc2c(o1)=CCCC=2.
What is the InChIKey of N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide?
The InChIKey is UHYTWTOQMYEJRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S/c10-9-14(11,12)8-5-6-3-1-2-4-7(6)13-8/h3-5,9-10H,1-2H2.
What are the key properties of N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide?
N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide has a molecular weight of 215.23 g/mol, XLogP of -0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-5,6-dihydro-1-benzofuran-2-sulfonamide is sourced from PubChem (CID 146650292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).