About (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine
(2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine (PubChem CID 146650799) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine.
Molecular Properties
| Compound Name | (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine |
| PubChem CID | 146650799 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine |
| SMILES | [H]/N=C/C(=C)CC/C=C\CNC |
| InChI | InChI=1S/C9H16N2/c1-9(8-10)6-4-3-5-7-11-2/h3,5,8,10-11H,1,4,6-7H2,2H3/b5-3-,10-8+ |
| InChIKey | ICARIZQZYLRYFM-WEZLDLNLSA-N |
| XLogP | 1.75 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine?
The IUPAC name of (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine (CID 146650799) is (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine.
What is the SMILES notation for (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine?
The canonical SMILES for (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine is [H]/N=C/C(=C)CC/C=C\CNC.
What is the InChIKey of (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine?
The InChIKey is ICARIZQZYLRYFM-WEZLDLNLSA-N. The full InChI is InChI=1S/C9H16N2/c1-9(8-10)6-4-3-5-7-11-2/h3,5,8,10-11H,1,4,6-7H2,2H3/b5-3-,10-8+.
What are the key properties of (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine?
(2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine has a molecular weight of 152.24 g/mol, XLogP of 1.75, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-6-methanimidoyl-N-methylhepta-2,6-dien-1-amine is sourced from PubChem (CID 146650799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).