N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride

C9H14FN — CID 146650849

IUPACN-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride
SMILESC=C/C(=C\N=C(/C)F)C(C)C
InChIInChI=1S/C9H14FN/c1-5-9(7(2)3)6-11-8(4)10/h5-7H,1H2,2-4H3/b9-6+,11-8+
InChIKeyDOBISTGWSDGCEZ-DNLSTQPZSA-N
MW155.22 g/mol
LogP3.10
Rot. Bonds3

About N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride

N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride (PubChem CID 146650849) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride.

Molecular Properties

Compound NameN-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride
PubChem CID146650849
Molecular FormulaC9H14FN
Molecular Weight155.22 g/mol
Exact Mass155.11
IUPAC NameN-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride
SMILESC=C/C(=C\N=C(/C)F)C(C)C
InChIInChI=1S/C9H14FN/c1-5-9(7(2)3)6-11-8(4)10/h5-7H,1H2,2-4H3/b9-6+,11-8+
InChIKeyDOBISTGWSDGCEZ-DNLSTQPZSA-N
XLogP3.10
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.22
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride?
The IUPAC name of N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride (CID 146650849) is N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride.
What is the SMILES notation for N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride?
The canonical SMILES for N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride is C=C/C(=C\N=C(/C)F)C(C)C.
What is the InChIKey of N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride?
The InChIKey is DOBISTGWSDGCEZ-DNLSTQPZSA-N. The full InChI is InChI=1S/C9H14FN/c1-5-9(7(2)3)6-11-8(4)10/h5-7H,1H2,2-4H3/b9-6+,11-8+.
What are the key properties of N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride?
N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride has a molecular weight of 155.22 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride is sourced from PubChem (CID 146650849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).