About N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride
N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride (PubChem CID 146650849) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride.
Molecular Properties
| Compound Name | N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride |
| PubChem CID | 146650849 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride |
| SMILES | C=C/C(=C\N=C(/C)F)C(C)C |
| InChI | InChI=1S/C9H14FN/c1-5-9(7(2)3)6-11-8(4)10/h5-7H,1H2,2-4H3/b9-6+,11-8+ |
| InChIKey | DOBISTGWSDGCEZ-DNLSTQPZSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride?
The IUPAC name of N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride (CID 146650849) is N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride.
What is the SMILES notation for N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride?
The canonical SMILES for N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride is C=C/C(=C\N=C(/C)F)C(C)C.
What is the InChIKey of N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride?
The InChIKey is DOBISTGWSDGCEZ-DNLSTQPZSA-N. The full InChI is InChI=1S/C9H14FN/c1-5-9(7(2)3)6-11-8(4)10/h5-7H,1H2,2-4H3/b9-6+,11-8+.
What are the key properties of N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride?
N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride has a molecular weight of 155.22 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]ethanimidoyl fluoride is sourced from PubChem (CID 146650849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).