C19H40N2 — CID 146650917
N'-[3-(2,2-dimethylpropyl)-4,4-dimethylhept-6-enyl]-N-methylbutane-1,4-diamine (PubChem CID 146650917) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is N'-[3-(2,2-dimethylpropyl)-4,4-dimethylhept-6-enyl]-N-methylbutane-1,4-diamine.
| Compound Name | N'-[3-(2,2-dimethylpropyl)-4,4-dimethylhept-6-enyl]-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 146650917 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | N'-[3-(2,2-dimethylpropyl)-4,4-dimethylhept-6-enyl]-N-methylbutane-1,4-diamine |
| SMILES | C=CCC(C)(C)C(CCNCCCCNC)CC(C)(C)C |
| InChI | InChI=1S/C19H40N2/c1-8-12-19(5,6)17(16-18(2,3)4)11-15-21-14-10-9-13-20-7/h8,17,20-21H,1,9-16H2,2-7H3 |
| InChIKey | YQVCNIHIOIYCJD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|