C27H34N4O4S — CID 1466513
[4-[(7R)-2-ethyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 1466513) has the molecular formula C27H34N4O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is [4-[(7R)-2-ethyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [4-[(7R)-2-ethyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 1466513 |
| Molecular Formula | C27H34N4O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | [4-[(7R)-2-ethyl-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | CCc1nc(N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)CC2)c2c3c(sc2n1)C[C@H](C)CC3 |
| InChI | InChI=1S/C27H34N4O4S/c1-6-22-28-25(23-18-8-7-16(2)13-21(18)36-26(23)29-22)30-9-11-31(12-10-30)27(32)17-14-19(33-3)24(35-5)20(15-17)34-4/h14-16H,6-13H2,1-5H3/t16-/m1/s1 |
| InChIKey | POZYURJAXYRUTQ-MRXNPFEDSA-N |
| XLogP | 4.37 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |