C15H23N — CID 146651380
6-methylidene-N-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,4-dien-1-imine (PubChem CID 146651380) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 6-methylidene-N-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,4-dien-1-imine.
| Compound Name | 6-methylidene-N-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 146651380 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 6-methylidene-N-(2,4,4-trimethylpentan-2-yl)cyclohexa-2,4-dien-1-imine |
| SMILES | C=C1C=CC=C/C1=N\C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H23N/c1-12-9-7-8-10-13(12)16-15(5,6)11-14(2,3)4/h7-10H,1,11H2,2-6H3/b16-13+ |
| InChIKey | XBBYBPKFRMKFBG-DTQAZKPQSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|