C32H48F6O4 — CID 146651600
1,1,1,3,3,3-hexafluoropropan-2-yl 1-propan-2-yl-2-[3,5,6-trimethyl-5-(8-tricyclo[5.2.1.02,6]decanyloxycarbonyl)heptyl]cyclobutane-1-carboxylate (PubChem CID 146651600) has the molecular formula C32H48F6O4 and a molecular weight of 610.72 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 1-propan-2-yl-2-[3,5,6-trimethyl-5-(8-tricyclo[5.2.1.02,6]decanyloxycarbonyl)heptyl]cyclobutane-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-propan-2-yl-2-[3,5,6-trimethyl-5-(8-tricyclo[5.2.1.02,6]decanyloxycarbonyl)heptyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 146651600 |
| Molecular Formula | C32H48F6O4 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 1-propan-2-yl-2-[3,5,6-trimethyl-5-(8-tricyclo[5.2.1.02,6]decanyloxycarbonyl)heptyl]cyclobutane-1-carboxylate |
| SMILES | CC(CCC1CCC1(C(=O)OC(C(F)(F)F)C(F)(F)F)C(C)C)CC(C)(C(=O)OC1CC2CC1C1CCCC21)C(C)C |
| InChI | InChI=1S/C32H48F6O4/c1-17(2)29(6,27(39)41-25-15-20-14-24(25)23-9-7-8-22(20)23)16-19(5)10-11-21-12-13-30(21,18(3)4)28(40)42-26(31(33,34)35)32(36,37)38/h17-26H,7-16H2,1-6H3 |
| InChIKey | WULWGTHBYKTIML-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |