C18H21N — CID 146651690
5-[(1Z)-buta-1,3-dienyl]-3-[(3Z)-hexa-1,3,5-trien-2-yl]-4-[(Z)-prop-1-enyl]-3,4-dihydropyridine (PubChem CID 146651690) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-3-[(3Z)-hexa-1,3,5-trien-2-yl]-4-[(Z)-prop-1-enyl]-3,4-dihydropyridine.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-3-[(3Z)-hexa-1,3,5-trien-2-yl]-4-[(Z)-prop-1-enyl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 146651690 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-3-[(3Z)-hexa-1,3,5-trien-2-yl]-4-[(Z)-prop-1-enyl]-3,4-dihydropyridine |
| SMILES | C=C/C=C\C(=C)C1C=NC=C(/C=C\C=C)C1/C=C\C |
| InChI | InChI=1S/C18H21N/c1-5-8-11-15(4)18-14-19-13-16(12-9-6-2)17(18)10-7-3/h5-14,17-18H,1-2,4H2,3H3/b10-7-,11-8-,12-9- |
| InChIKey | BJPLVPKFKOIQJY-MDBXUZFLSA-N |
| XLogP | 4.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|