About (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine
(2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine (PubChem CID 146652702) has the molecular formula C14H29FN2
and a molecular weight of 244.40 g/mol. Its IUPAC name is (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine.
Molecular Properties
| Compound Name | (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine |
| PubChem CID | 146652702 |
| Molecular Formula | C14H29FN2 |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine |
| SMILES | CC1CN(C(C)(C)C)[C@H](CF)CN1C(C)(C)C |
| InChI | InChI=1S/C14H29FN2/c1-11-9-17(14(5,6)7)12(8-15)10-16(11)13(2,3)4/h11-12H,8-10H2,1-7H3/t11?,12-/m1/s1 |
| InChIKey | SNOOUMNIUMKICR-PIJUOVFKSA-N |
| XLogP | 2.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine?
The IUPAC name of (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine (CID 146652702) is (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine.
What is the SMILES notation for (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine?
The canonical SMILES for (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine is CC1CN(C(C)(C)C)[C@H](CF)CN1C(C)(C)C.
What is the InChIKey of (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine?
The InChIKey is SNOOUMNIUMKICR-PIJUOVFKSA-N. The full InChI is InChI=1S/C14H29FN2/c1-11-9-17(14(5,6)7)12(8-15)10-16(11)13(2,3)4/h11-12H,8-10H2,1-7H3/t11?,12-/m1/s1.
What are the key properties of (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine?
(2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine has a molecular weight of 244.40 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,4-ditert-butyl-2-(fluoromethyl)-5-methylpiperazine is sourced from PubChem (CID 146652702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).