About 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine
4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine (PubChem CID 146652769) has the molecular formula C8H16FNO
and a molecular weight of 161.22 g/mol. Its IUPAC name is 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine.
Analyze 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine?
The IUPAC name of 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine (CID 146652769) is 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine.
What is the SMILES notation for 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine?
The canonical SMILES for 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine is COCC1(C)CC(F)CN1C.
What is the InChIKey of 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine?
The InChIKey is OPWAOUUHCRGJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FNO/c1-8(6-11-3)4-7(9)5-10(8)2/h7H,4-6H2,1-3H3.
What are the key properties of 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine?
4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine has a molecular weight of 161.22 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-(methoxymethyl)-1,2-dimethylpyrrolidine is sourced from PubChem (CID 146652769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).