About 4-N-butyl-2H-azepine-2,4-diamine
4-N-butyl-2H-azepine-2,4-diamine (PubChem CID 146653296) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 4-N-butyl-2H-azepine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-butyl-2H-azepine-2,4-diamine |
| PubChem CID | 146653296 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 4-N-butyl-2H-azepine-2,4-diamine |
| SMILES | CCCCNC1=CC(N)N=CC=C1 |
| InChI | InChI=1S/C10H17N3/c1-2-3-6-12-9-5-4-7-13-10(11)8-9/h4-5,7-8,10,12H,2-3,6,11H2,1H3 |
| InChIKey | RLNORMNEIRGRDU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N-butyl-2H-azepine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-butyl-2H-azepine-2,4-diamine?
The IUPAC name of 4-N-butyl-2H-azepine-2,4-diamine (CID 146653296) is 4-N-butyl-2H-azepine-2,4-diamine.
What is the SMILES notation for 4-N-butyl-2H-azepine-2,4-diamine?
The canonical SMILES for 4-N-butyl-2H-azepine-2,4-diamine is CCCCNC1=CC(N)N=CC=C1.
What is the InChIKey of 4-N-butyl-2H-azepine-2,4-diamine?
The InChIKey is RLNORMNEIRGRDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-2-3-6-12-9-5-4-7-13-10(11)8-9/h4-5,7-8,10,12H,2-3,6,11H2,1H3.
What are the key properties of 4-N-butyl-2H-azepine-2,4-diamine?
4-N-butyl-2H-azepine-2,4-diamine has a molecular weight of 179.27 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-butyl-2H-azepine-2,4-diamine is sourced from PubChem (CID 146653296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).