About 2-benzylthianthrene
2-benzylthianthrene (PubChem CID 14665337) has the molecular formula C19H14S2
and a molecular weight of 306.46 g/mol. Its IUPAC name is 2-benzylthianthrene.
Molecular Properties
| Compound Name | 2-benzylthianthrene |
| PubChem CID | 14665337 |
| Molecular Formula | C19H14S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-benzylthianthrene |
| SMILES | c1ccc(Cc2ccc3c(c2)Sc2ccccc2S3)cc1 |
| InChI | InChI=1S/C19H14S2/c1-2-6-14(7-3-1)12-15-10-11-18-19(13-15)21-17-9-5-4-8-16(17)20-18/h1-11,13H,12H2 |
| InChIKey | VXWVUGBADVPGRE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylthianthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylthianthrene?
The IUPAC name of 2-benzylthianthrene (CID 14665337) is 2-benzylthianthrene.
What is the SMILES notation for 2-benzylthianthrene?
The canonical SMILES for 2-benzylthianthrene is c1ccc(Cc2ccc3c(c2)Sc2ccccc2S3)cc1.
What is the InChIKey of 2-benzylthianthrene?
The InChIKey is VXWVUGBADVPGRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14S2/c1-2-6-14(7-3-1)12-15-10-11-18-19(13-15)21-17-9-5-4-8-16(17)20-18/h1-11,13H,12H2.
What are the key properties of 2-benzylthianthrene?
2-benzylthianthrene has a molecular weight of 306.46 g/mol, XLogP of 5.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylthianthrene is sourced from PubChem (CID 14665337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).