C24H17F4N5O — CID 146653483
4-[[4-[2-fluoro-6-(3,3,3-trifluoropropylamino)-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile (PubChem CID 146653483) has the molecular formula C24H17F4N5O and a molecular weight of 467.43 g/mol. Its IUPAC name is 4-[[4-[2-fluoro-6-(3,3,3-trifluoropropylamino)-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[2-fluoro-6-(3,3,3-trifluoropropylamino)-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 146653483 |
| Molecular Formula | C24H17F4N5O |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 4-[[4-[2-fluoro-6-(3,3,3-trifluoropropylamino)-3-pyridinyl]-1-oxophthalazin-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2nc(-c3ccc(NCCC(F)(F)F)nc3F)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H17F4N5O/c25-22-19(9-10-20(31-22)30-12-11-24(26,27)28)21-17-3-1-2-4-18(17)23(34)33(32-21)14-16-7-5-15(13-29)6-8-16/h1-10H,11-12,14H2,(H,30,31) |
| InChIKey | SXPFEJCOVLLFBF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|