C36H30N4O4 — CID 146653646
6-hydroxy-8,17,19-trioxo-7,18-di(pentan-2-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-11,26-dicarbonitrile (PubChem CID 146653646) has the molecular formula C36H30N4O4 and a molecular weight of 582.66 g/mol. Its IUPAC name is 6-hydroxy-8,17,19-trioxo-7,18-di(pentan-2-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-11,26-dicarbonitrile.
| Compound Name | 6-hydroxy-8,17,19-trioxo-7,18-di(pentan-2-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-11,26-dicarbonitrile |
|---|---|
| PubChem CID | 146653646 |
| Molecular Formula | C36H30N4O4 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 6-hydroxy-8,17,19-trioxo-7,18-di(pentan-2-yl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-11,26-dicarbonitrile |
| SMILES | CCCC(C)N1C(=O)c2ccc3c4c(C#N)cc5c6c(cc(C#N)c(c7ccc(c2c37)C1=O)c64)C(O)N(C(C)CCC)C5=O |
| InChI | InChI=1S/C36H30N4O4/c1-5-7-17(3)39-33(41)23-11-9-21-27-19(15-37)13-25-31-26(36(44)40(35(25)43)18(4)8-6-2)14-20(16-38)28(32(27)31)22-10-12-24(34(39)42)30(23)29(21)22/h9-14,17-18,35,43H,5-8H2,1-4H3 |
| InChIKey | LAGZCUQYFWKXQO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|