C23H12F9NO3S — CID 146653709
(6-quinolin-8-ylnaphthalen-2-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 146653709) has the molecular formula C23H12F9NO3S and a molecular weight of 553.40 g/mol. Its IUPAC name is (6-quinolin-8-ylnaphthalen-2-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (6-quinolin-8-ylnaphthalen-2-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 146653709 |
| Molecular Formula | C23H12F9NO3S |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | (6-quinolin-8-ylnaphthalen-2-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1ccc2cc(-c3cccc4cccnc34)ccc2c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H12F9NO3S/c24-20(25,22(28,29)30)21(26,27)23(31,32)37(34,35)36-17-9-8-14-11-16(7-6-15(14)12-17)18-5-1-3-13-4-2-10-33-19(13)18/h1-12H |
| InChIKey | MVLKETYUPCEZTC-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|