C17H24N4O — CID 146653745
N'-(1-butyl-2-oxo-3,4-dihydro-1,5-naphthyridin-3-yl)-1-methylcyclopropane-1-carboximidamide (PubChem CID 146653745) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N'-(1-butyl-2-oxo-3,4-dihydro-1,5-naphthyridin-3-yl)-1-methylcyclopropane-1-carboximidamide.
| Compound Name | N'-(1-butyl-2-oxo-3,4-dihydro-1,5-naphthyridin-3-yl)-1-methylcyclopropane-1-carboximidamide |
|---|---|
| PubChem CID | 146653745 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N'-(1-butyl-2-oxo-3,4-dihydro-1,5-naphthyridin-3-yl)-1-methylcyclopropane-1-carboximidamide |
| SMILES | CCCCN1C(=O)C(/N=C(\N)C2(C)CC2)Cc2ncccc21 |
| InChI | InChI=1S/C17H24N4O/c1-3-4-10-21-14-6-5-9-19-12(14)11-13(15(21)22)20-16(18)17(2)7-8-17/h5-6,9,13H,3-4,7-8,10-11H2,1-2H3,(H2,18,20) |
| InChIKey | QWMRGOXJLLGKOW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|