About 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile
4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile (PubChem CID 146653930) has the molecular formula C26H22N2
and a molecular weight of 362.48 g/mol. Its IUPAC name is 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile |
| PubChem CID | 146653930 |
| Molecular Formula | C26H22N2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile |
| SMILES | C=CC(C)(C)Cc1ccc2cncc(-c3ccc(C#N)c4ccccc34)c2c1 |
| InChI | InChI=1S/C26H22N2/c1-4-26(2,3)14-18-9-10-20-16-28-17-25(24(20)13-18)23-12-11-19(15-27)21-7-5-6-8-22(21)23/h4-13,16-17H,1,14H2,2-3H3 |
| InChIKey | LBHWFVSZPHWSNC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile?
The IUPAC name of 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile (CID 146653930) is 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile.
What is the SMILES notation for 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile?
The canonical SMILES for 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile is C=CC(C)(C)Cc1ccc2cncc(-c3ccc(C#N)c4ccccc34)c2c1.
What is the InChIKey of 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile?
The InChIKey is LBHWFVSZPHWSNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2/c1-4-26(2,3)14-18-9-10-20-16-28-17-25(24(20)13-18)23-12-11-19(15-27)21-7-5-6-8-22(21)23/h4-13,16-17H,1,14H2,2-3H3.
What are the key properties of 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile?
4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile has a molecular weight of 362.48 g/mol, XLogP of 6.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(2,2-dimethylbut-3-enyl)isoquinolin-4-yl]naphthalene-1-carbonitrile is sourced from PubChem (CID 146653930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).