C40H27N3 — CID 146654283
4-[3-[1-[8-(methylideneamino)-7-[(Z)-prop-1-enyl]quinolin-2-yl]naphthalen-2-yl]naphthalen-2-yl]benzonitrile (PubChem CID 146654283) has the molecular formula C40H27N3 and a molecular weight of 549.68 g/mol. Its IUPAC name is 4-[3-[1-[8-(methylideneamino)-7-[(Z)-prop-1-enyl]quinolin-2-yl]naphthalen-2-yl]naphthalen-2-yl]benzonitrile.
| Compound Name | 4-[3-[1-[8-(methylideneamino)-7-[(Z)-prop-1-enyl]quinolin-2-yl]naphthalen-2-yl]naphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 146654283 |
| Molecular Formula | C40H27N3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 4-[3-[1-[8-(methylideneamino)-7-[(Z)-prop-1-enyl]quinolin-2-yl]naphthalen-2-yl]naphthalen-2-yl]benzonitrile |
| SMILES | C=Nc1c(/C=C\C)ccc2ccc(-c3c(-c4cc5ccccc5cc4-c4ccc(C#N)cc4)ccc4ccccc34)nc12 |
| InChI | InChI=1S/C40H27N3/c1-3-8-29-17-18-30-20-22-37(43-40(30)39(29)42-2)38-33-12-7-6-9-27(33)19-21-34(38)36-24-32-11-5-4-10-31(32)23-35(36)28-15-13-26(25-41)14-16-28/h3-24H,2H2,1H3/b8-3- |
| InChIKey | ZASXKLKLVJRKBK-BAQGIRSFSA-N |
| XLogP | 10.78 |
| TPSA | 49.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|