C27H37N5O4 — CID 146654386
2-[3,5-dimethoxy-4-(2-methylpropyl)phenyl]-7-(1-prop-2-enoylpiperidin-4-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 146654386) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 2-[3,5-dimethoxy-4-(2-methylpropyl)phenyl]-7-(1-prop-2-enoylpiperidin-4-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-[3,5-dimethoxy-4-(2-methylpropyl)phenyl]-7-(1-prop-2-enoylpiperidin-4-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 146654386 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 2-[3,5-dimethoxy-4-(2-methylpropyl)phenyl]-7-(1-prop-2-enoylpiperidin-4-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCC(C2CCNc3c(C(N)=O)c(-c4cc(OC)c(CC(C)C)c(OC)c4)nn32)CC1 |
| InChI | InChI=1S/C27H37N5O4/c1-6-23(33)31-11-8-17(9-12-31)20-7-10-29-27-24(26(28)34)25(30-32(20)27)18-14-21(35-4)19(13-16(2)3)22(15-18)36-5/h6,14-17,20,29H,1,7-13H2,2-5H3,(H2,28,34) |
| InChIKey | DVKOAKSISKGQNW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|