About 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine
2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 146654884) has the molecular formula C20H17ClN4
and a molecular weight of 348.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| PubChem CID | 146654884 |
| Molecular Formula | C20H17ClN4 |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(C)c(Nc2nc(-c3cccc(Cl)c3)nc3cc[nH]c23)c1 |
| InChI | InChI=1S/C20H17ClN4/c1-12-6-7-13(2)17(10-12)24-20-18-16(8-9-22-18)23-19(25-20)14-4-3-5-15(21)11-14/h3-11,22H,1-2H3,(H,23,24,25) |
| InChIKey | UXCHLEDLGPVMDB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine?
The IUPAC name of 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine (CID 146654884) is 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine is Cc1ccc(C)c(Nc2nc(-c3cccc(Cl)c3)nc3cc[nH]c23)c1.
What is the InChIKey of 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine?
The InChIKey is UXCHLEDLGPVMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN4/c1-12-6-7-13(2)17(10-12)24-20-18-16(8-9-22-18)23-19(25-20)14-4-3-5-15(21)11-14/h3-11,22H,1-2H3,(H,23,24,25).
What are the key properties of 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine?
2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine has a molecular weight of 348.84 g/mol, XLogP of 5.64, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-N-(2,5-dimethylphenyl)-5H-pyrrolo[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 146654884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).