C16H21F2NO3 — CID 146655225
tert-butyl (4R)-4-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]-2-oxopyrrolidine-1-carboxylate (PubChem CID 146655225) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146655225 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl (4R)-4-[(3E,5E)-4,6-difluorohepta-1,3,5-trien-2-yl]-2-oxopyrrolidine-1-carboxylate |
| SMILES | C=C(/C=C(F)\C=C(/C)F)[C@H]1CC(=O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H21F2NO3/c1-10(6-13(18)7-11(2)17)12-8-14(20)19(9-12)15(21)22-16(3,4)5/h6-7,12H,1,8-9H2,2-5H3/b11-7+,13-6+/t12-/m0/s1 |
| InChIKey | UQTCNAWRAWDDHC-RVEYNQIKSA-N |
| XLogP | 4.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|