C47H24N8O — CID 146655753
3-(6-cyanopyrido[3,4-b]indol-9-yl)-9-spiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,9'-xanthene]-2'-ylpyrido[3,4-b]indole-6-carbonitrile (PubChem CID 146655753) has the molecular formula C47H24N8O and a molecular weight of 716.76 g/mol. Its IUPAC name is 3-(6-cyanopyrido[3,4-b]indol-9-yl)-9-spiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,9'-xanthene]-2'-ylpyrido[3,4-b]indole-6-carbonitrile.
| Compound Name | 3-(6-cyanopyrido[3,4-b]indol-9-yl)-9-spiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,9'-xanthene]-2'-ylpyrido[3,4-b]indole-6-carbonitrile |
|---|---|
| PubChem CID | 146655753 |
| Molecular Formula | C47H24N8O |
| Molecular Weight | 716.76 g/mol |
| Exact Mass | 716.21 |
| IUPAC Name | 3-(6-cyanopyrido[3,4-b]indol-9-yl)-9-spiro[3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-8,9'-xanthene]-2'-ylpyrido[3,4-b]indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c1cc(-n3c4ccc(C#N)cc4c4ccncc43)ncc1n2-c1ccc2c(c1)C1(c3ccccc3O2)c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/C47H24N8O/c48-23-27-10-13-39-31(19-27)30-15-18-50-25-40(30)55(39)44-22-33-32-20-28(24-49)9-12-38(32)54(41(33)26-53-44)29-11-14-43-37(21-29)47(34-5-1-2-8-42(34)56-43)35-6-3-16-51-45(35)46-36(47)7-4-17-52-46/h1-22,25-26H |
| InChIKey | LXWBDJLFZHIYPL-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 118.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.76 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |