C21H14F5N — CID 146656335
1,2-difluoro-3,6-dimethyl-9-(2,3,5-trifluoro-4-methylphenyl)carbazole (PubChem CID 146656335) has the molecular formula C21H14F5N and a molecular weight of 375.34 g/mol. Its IUPAC name is 1,2-difluoro-3,6-dimethyl-9-(2,3,5-trifluoro-4-methylphenyl)carbazole.
| Compound Name | 1,2-difluoro-3,6-dimethyl-9-(2,3,5-trifluoro-4-methylphenyl)carbazole |
|---|---|
| PubChem CID | 146656335 |
| Molecular Formula | C21H14F5N |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1,2-difluoro-3,6-dimethyl-9-(2,3,5-trifluoro-4-methylphenyl)carbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)c(F)c(F)c1n2-c1cc(F)c(C)c(F)c1F |
| InChI | InChI=1S/C21H14F5N/c1-9-4-5-15-12(6-9)13-7-10(2)17(23)20(26)21(13)27(15)16-8-14(22)11(3)18(24)19(16)25/h4-8H,1-3H3 |
| InChIKey | IGQZGGDFAOHQNO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|