C14H30FN — CID 146656443
4-fluoro-2,3,3,4,5,5,6-heptamethylheptan-2-amine (PubChem CID 146656443) has the molecular formula C14H30FN and a molecular weight of 231.40 g/mol. Its IUPAC name is 4-fluoro-2,3,3,4,5,5,6-heptamethylheptan-2-amine.
| Compound Name | 4-fluoro-2,3,3,4,5,5,6-heptamethylheptan-2-amine |
|---|---|
| PubChem CID | 146656443 |
| Molecular Formula | C14H30FN |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.24 |
| IUPAC Name | 4-fluoro-2,3,3,4,5,5,6-heptamethylheptan-2-amine |
| SMILES | CC(C)C(C)(C)C(C)(F)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C14H30FN/c1-10(2)11(3,4)14(9,15)12(5,6)13(7,8)16/h10H,16H2,1-9H3 |
| InChIKey | RDODUJYYVCVMHP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |