C12H16ClN5O2 — CID 146656544
4-(chloroamino)-2-[[(1R,2S)-2-hydroxycyclohexyl]amino]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 146656544) has the molecular formula C12H16ClN5O2 and a molecular weight of 297.75 g/mol. Its IUPAC name is 4-(chloroamino)-2-[[(1R,2S)-2-hydroxycyclohexyl]amino]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 4-(chloroamino)-2-[[(1R,2S)-2-hydroxycyclohexyl]amino]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 146656544 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-(chloroamino)-2-[[(1R,2S)-2-hydroxycyclohexyl]amino]-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | O=C1NCc2nc(N[C@@H]3CCCC[C@@H]3O)nc(NCl)c21 |
| InChI | InChI=1S/C12H16ClN5O2/c13-18-10-9-7(5-14-11(9)20)16-12(17-10)15-6-3-1-2-4-8(6)19/h6,8,19H,1-5H2,(H,14,20)(H2,15,16,17,18)/t6-,8+/m1/s1 |
| InChIKey | RSPXDBCZYXRSPF-SVRRBLITSA-N |
| XLogP | 1.00 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|