C27H29N9O4S2 — CID 146656816
5-[[(1S,2R)-2-aminocyclohexyl]amino]-7-[[5-(5-morpholin-4-yl-7-oxothiopyrano[3,2-b]furan-3-yl)thiophen-3-yl]amino]-[1,2,4]triazolo[4,3-c]pyrimidine-8-carboxamide (PubChem CID 146656816) has the molecular formula C27H29N9O4S2 and a molecular weight of 607.72 g/mol. Its IUPAC name is 5-[[(1S,2R)-2-aminocyclohexyl]amino]-7-[[5-(5-morpholin-4-yl-7-oxothiopyrano[3,2-b]furan-3-yl)thiophen-3-yl]amino]-[1,2,4]triazolo[4,3-c]pyrimidine-8-carboxamide.
| Compound Name | 5-[[(1S,2R)-2-aminocyclohexyl]amino]-7-[[5-(5-morpholin-4-yl-7-oxothiopyrano[3,2-b]furan-3-yl)thiophen-3-yl]amino]-[1,2,4]triazolo[4,3-c]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 146656816 |
| Molecular Formula | C27H29N9O4S2 |
| Molecular Weight | 607.72 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | 5-[[(1S,2R)-2-aminocyclohexyl]amino]-7-[[5-(5-morpholin-4-yl-7-oxothiopyrano[3,2-b]furan-3-yl)thiophen-3-yl]amino]-[1,2,4]triazolo[4,3-c]pyrimidine-8-carboxamide |
| SMILES | NC(=O)c1c(Nc2csc(-c3coc4c(=O)cc(N5CCOCC5)sc34)c2)nc(N[C@H]2CCCC[C@H]2N)n2cnnc12 |
| InChI | InChI=1S/C27H29N9O4S2/c28-16-3-1-2-4-17(16)32-27-33-25(21(24(29)38)26-34-30-13-36(26)27)31-14-9-19(41-12-14)15-11-40-22-18(37)10-20(42-23(15)22)35-5-7-39-8-6-35/h9-13,16-17,31H,1-8,28H2,(H2,29,38)(H,32,33)/t16-,17+/m1/s1 |
| InChIKey | VSPPRTXFAFRCEM-SJORKVTESA-N |
| XLogP | 3.38 |
| TPSA | 178.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.72 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |