About 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine
2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine (PubChem CID 146656885) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine.
Molecular Properties
| Compound Name | 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine |
| PubChem CID | 146656885 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine |
| SMILES | C=C(C)CC(CC)CC(C)C(C)C1CN1 |
| InChI | InChI=1S/C14H27N/c1-6-13(7-10(2)3)8-11(4)12(5)14-9-15-14/h11-15H,2,6-9H2,1,3-5H3 |
| InChIKey | CUDFHFCPUSYPGI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine?
The IUPAC name of 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine (CID 146656885) is 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine.
What is the SMILES notation for 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine?
The canonical SMILES for 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine is C=C(C)CC(CC)CC(C)C(C)C1CN1.
What is the InChIKey of 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine?
The InChIKey is CUDFHFCPUSYPGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N/c1-6-13(7-10(2)3)8-11(4)12(5)14-9-15-14/h11-15H,2,6-9H2,1,3-5H3.
What are the key properties of 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine?
2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine has a molecular weight of 209.38 g/mol, XLogP of 3.61, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-3,7-dimethyloct-7-en-2-yl)aziridine is sourced from PubChem (CID 146656885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).