C15H19F2N5O4 — CID 146657497
(5R)-11-(2,2-difluoroethoxymethyl)-5,13-dimethyl-14-oxo-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-triene-4-carboxylic acid (PubChem CID 146657497) has the molecular formula C15H19F2N5O4 and a molecular weight of 371.34 g/mol. Its IUPAC name is (5R)-11-(2,2-difluoroethoxymethyl)-5,13-dimethyl-14-oxo-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-triene-4-carboxylic acid.
| Compound Name | (5R)-11-(2,2-difluoroethoxymethyl)-5,13-dimethyl-14-oxo-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 146657497 |
| Molecular Formula | C15H19F2N5O4 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (5R)-11-(2,2-difluoroethoxymethyl)-5,13-dimethyl-14-oxo-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-triene-4-carboxylic acid |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)O)C(=O)N(C)N=C(COCC(F)F)C3 |
| InChI | InChI=1S/C15H19F2N5O4/c1-8-3-11-10(5-21(8)15(24)25)13-14(23)20(2)18-9(4-22(13)19-11)6-26-7-12(16)17/h8,12H,3-7H2,1-2H3,(H,24,25)/t8-/m1/s1 |
| InChIKey | DRVDRIFGSHBRDE-MRVPVSSYSA-N |
| XLogP | 1.03 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |