C12H12F3N5O3 — CID 146657506
13-methyl-14-oxo-11-(trifluoromethyl)-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-triene-4-carboxylic acid (PubChem CID 146657506) has the molecular formula C12H12F3N5O3 and a molecular weight of 331.25 g/mol. Its IUPAC name is 13-methyl-14-oxo-11-(trifluoromethyl)-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-triene-4-carboxylic acid.
| Compound Name | 13-methyl-14-oxo-11-(trifluoromethyl)-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 146657506 |
| Molecular Formula | C12H12F3N5O3 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 13-methyl-14-oxo-11-(trifluoromethyl)-4,8,9,12,13-pentazatricyclo[7.5.0.02,7]tetradeca-1,7,11-triene-4-carboxylic acid |
| SMILES | CN1N=C(C(F)(F)F)Cn2nc3c(c2C1=O)CN(C(=O)O)CC3 |
| InChI | InChI=1S/C12H12F3N5O3/c1-18-10(21)9-6-4-19(11(22)23)3-2-7(6)16-20(9)5-8(17-18)12(13,14)15/h2-5H2,1H3,(H,22,23) |
| InChIKey | DOEJDUBCXGYDIE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |