C21H22BrF4N5O4 — CID 146657546
(5R,11R)-N-(5-bromo-2,4-difluorophenyl)-11-(2,2-difluoroethoxymethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 146657546) has the molecular formula C21H22BrF4N5O4 and a molecular weight of 564.33 g/mol. Its IUPAC name is (5R,11R)-N-(5-bromo-2,4-difluorophenyl)-11-(2,2-difluoroethoxymethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (5R,11R)-N-(5-bromo-2,4-difluorophenyl)-11-(2,2-difluoroethoxymethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 146657546 |
| Molecular Formula | C21H22BrF4N5O4 |
| Molecular Weight | 564.33 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | (5R,11R)-N-(5-bromo-2,4-difluorophenyl)-11-(2,2-difluoroethoxymethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)Nc1cc(Br)c(F)cc1F)C(=O)N(C)O[C@@H](COCC(F)F)C3 |
| InChI | InChI=1S/C21H22BrF4N5O4/c1-10-3-16-12(7-30(10)21(33)27-17-4-13(22)14(23)5-15(17)24)19-20(32)29(2)35-11(6-31(19)28-16)8-34-9-18(25)26/h4-5,10-11,18H,3,6-9H2,1-2H3,(H,27,33)/t10-,11-/m1/s1 |
| InChIKey | IDUIHWPDGBNZNV-GHMZBOCLSA-N |
| XLogP | 3.57 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|